Urolitin B por

November 9, 2020

A Cofttek a legjobb Urolithin B por gyártó Kínában. Üzemünk teljes termelésirányítási rendszerrel (ISO9001 és ISO14001) rendelkezik, havi 200 kg termelési kapacitással.

 


Állapot: A tömegtermelésben
Egység: 1kg / zsák, 25kg / dob

Urolithin BSECHNIKAI

Név: Urolitin B
Kémiai név: 3-Hidroxi-6H-dibenzo [b, d] pirán-6-on
CAS: 1139-83-9
Kémiai formula: C13H8O3
Molekuláris tömeg: X
Szín:  Fehér por
InChi kulcs: WXUQMTRHPNOXBV-UHFFFAOYSA-N
SMILES kód: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
Funkció: Az urolithin B javíthatja a mitokondriális és izomműködést.

Az Urolithin B javítja az izomerőt és az állóképességet az öregedés során.

Alkalmazás: Az urolithin B az ellagitannis bélben található mikrobiális metabolitja, és erős antioxidáns és prooxidáns aktivitást mutat, a vizsgálati rendszertől és a körülményektől függően. Az Urolithin B ösztrogén és / vagy antiösztrogén aktivitást is mutathat.
Oldékonyság: Könnyen oldódik N, N-dimetil-formamidban és dimetil-metilénben. Szulfon, metanolban, etanolban és etil-acetátban kissé oldódik
Tárolási hőmérséklet: Higroszkópos, -20 ° C Fagyasztó, Inert atmoszférában
Szállítási állapot: A környezeti hőmérsékleten nem veszélyes vegyi anyagként szállítják. Ez a termék elég stabil ahhoz, hogy néhány hét alatt a szokásos szállítás és a vám alatt töltött idő.

 

Urolitin B NMR-spektrum

Urolitin B (1139-83-9) - NMR-spektrum

 

Ha minden egyes termékhez COA-ra, MSDS-re és HNMR-re és egyéb információkra van szüksége, kérjük, lépjen kapcsolatba velünk marketing menedzser.

 

Bevezetés az urolitinokba

Az urolitinek az ellaginsav másodlagos metabolitjai, amelyek elagitanninokból származnak. Emberben az ellagitanninokat a bél mikroflórája ellaginsavvá alakítja, amely a vastagbélben tovább alakul át urolitin A, urolitin B, urolitin C és urolitin D formává.

Az urolithin A (UA) az ellagitanninok legelterjedtebb metabolitja. Az urolithin A azonban természetesen nem fordul elő természetes táplálékforrásokban.

Az urolithin B (UB) bőséges metabolit, amely az ellagitanninok átalakulásával a bélben termelődik. Az urolitin B az utolsó termék az összes többi urolitin-származék katabolizálása után. Az urolithin B a vizeletben urolithin B glükuronidként található.

Az urolithin A 8-metil-éter az Urolithin A szintézise során keletkező köztitermék. Az ellagitannin jelentős másodlagos metabolitja, antioxidáns és gyulladáscsökkentő tulajdonságokkal rendelkezik.

 

Az A és B urolitin hatásmechanizmusa

● Az urolithin A mitofágiát indukál

A mitofágia az autofágia egyik formája, amely elősegíti a sérült mitokondriumok eltávolítását az optimális működésük érdekében. Az autofágia arra az általános folyamatra utal, amelyben a citoplazma tartalma lebomlik és következésképpen újrahasznosul, míg a mitofágia a mitokondriumok lebomlása és újrahasznosítása.

Az öregedés során az autofágia csökkenése az egyik szempont, amely a mitokondriális funkció csökkenéséhez vezet. Továbbá az oxidatív stressz alacsony autofágia kialakulásához is vezethet. Az urolithin A képes arra, hogy szelektív autofágia révén megszüntesse a sérült mitokondriumokat.

● Antioxidáns tulajdonságok

Oxidatív stressz akkor fordul elő, amikor a szervezetben a szabad gyökök és az antioxidáns egyensúlyhiány áll fenn. Ezeket a szabad gyököket gyakran sok krónikus betegség, például szívbetegség, cukorbetegség és rák társítja.

Az A és B urolitinek antioxidáns hatást mutatnak, mivel képesek csökkenteni a szabad gyököket és különösen az intracelluláris reaktív oxigén fajok (ROS) szintjét, és bizonyos sejttípusokban gátolják a lipid peroxidációt is.

Az urolitinok képesek gátolni néhány oxidáló enzimet, beleértve a monoamin-oxidáz A-t és a tirozinázt.

● Gyulladáscsökkentő tulajdonságok

A gyulladás egy természetes folyamat, amelyben testünk minden elesett dolog ellen küzd, például fertőzések, sérülések és mikrobák ellen. A krónikus gyulladás azonban káros lehet a szervezet számára, mivel ez különféle rendellenességekkel, például asztmával, szívproblémákkal és rákkal társul. Krónikus gyulladás fordulhat elő kezeletlen akut gyulladás, fertőzések vagy akár a szervezetben lévő szabad gyökök miatt.

Az A és B urolitinek gyulladásgátló tulajdonságokat mutatnak, mivel gátolják a salétrom-oxid termelést. Specifikusan gátolják az indukálható salétrom-oxid-szintáz (iNOS) fehérjét és az mRNS expressziót, amelyek felelősek a gyulladásért.

● Antimikrobiális hatások

A mikrobák, beleértve a baktériumokat, gombákat és vírusokat, természetesen előfordulnak a környezetben, sőt az emberi testben is. Néhány kórokozónak nevezett mikrobák azonban fertőző betegségeket okozhatnak, mint például influenza, kanyaró és malária.

Az urolithin A és B a kvórumérzékelés gátlásával képesek antimikrobiális aktivitást mutatni. A kvórumérzékelés egy olyan baktériumkommunikáció, amely lehetővé teszi a baktériumok számára a fertőzéssel kapcsolatos folyamatok, például virulencia és motilitás észlelését és ellenőrzését.

● A fehérje glikáció gátlása

A glikáció egy cukor nem enzimes kötődését jelenti egy lipidhez vagy fehérjéhez. Ez kulcsfontosságú biomarker a cukorbetegségben és más rendellenességekben, valamint az öregedésben.

A magas fehérje-glikáció a hiperglikémia másodlagos hatása nagy szerepet játszik a kardiovaszkuláris rendellenességekben, mint például a cukorbetegség és az Alzheimer-kór.

Az Urolithin A és B antiglikátív tulajdonságokkal rendelkezik, amelyek dózisfüggőek, függetlenek antioxidáns aktivitástól.

 

Az Urolithin B előnyei

Az urolitin B-kiegészítőknek számos egészségügyi előnye is van, amelyek többsége hasonló az urolithin A-hoz.

(1) Daganatellenes potenciál
Az urolithin B gyulladáscsökkentő tulajdonságai jó jelöltként szolgálnak a rák elleni küzdelemben. Egyes kutatók beszámoltak erről a potenciálról a fibroblasztokban, a mikrofágokban és az endotélsejtekben.

A tanulmányok szerint az UB gátolja a rák különféle típusait, például a prosztata-, vastagbél- és hólyagrákot.

Az emberi vastagbélrákos sejteket bevonó tanulmányban az ellagitannineket, az ellagicsavat, valamint az A és B urolithineket rák elleni képességük szempontjából értékelték. Azt jelentették, hogy az összes kezelés képes gátolni a rákos sejtek növekedését. Gátolják a rákos sejtek szaporodását a sejtciklus leállításával a különböző fázisokban, valamint az apoptózis indukciójával.

(2) Segíthet az oxidatív stressz elleni küzdelemben
Az urolitin B kitűnő antioxidáns tulajdonságokkal rendelkezik azáltal, hogy bizonyos sejttípusokban csökkenti a reaktív oxigénfajták szintjét és a lipidperoxidációt. A ROS magas szintje sok rendellenességhez kapcsolódik, például Alzheimer-kórhoz.

Egy oxidatív stressznek kitett neuronális sejtekkel végzett vizsgálat során úgy találták, hogy az urolithin B kiegészítő, valamint az urolithin A védi a sejteket az oxidációtól, ezáltal növeli a sejtek túlélését.

(3) Urolithin B a memória javításában
Úgy tűnik, hogy az urolithin b javítja a vérgát permeabilitását. Ez javítja a kognitív működést.

A tanulmányok azt mutatják, hogy az urolithin B potenciális memóriajavító lehet azáltal, hogy javítja az általános kognitív működést.

(4) Megakadályozza az izomvesztést
Az izomvesztés különféle okok miatt fordulhat elő, például rendellenességek, öregedés és az étrend fehérjehiánya. Számos intézkedés alkalmazható az izomvesztés megállítására, korlátozására vagy jobb megelőzésére, ideértve a testmozgást, a gyógyszereket és az aminosavakat, valamint a polifenolokat.

Az urolitineket polifenolokként lehet besorolni és szerepet játszanak az izomvesztés megelőzésében az izomfehérje szintézis aktiválásával és a lebomlás lelassításával.

Egy egerekkel végzett vizsgálatban azt találták, hogy egy ideig beadott Urolithin B kiegészítők elősegítik izomfejlődésüket, mivel az izmok megnövekedtek.

(5) Az Urolithin B küzd a gyulladás ellen
Az urolithin B gyulladásgátló tulajdonságokkal rendelkezik, mivel csökkenti a legtöbb gyulladásjelzőt.

Egy indukált vesefibrózisban szenvedő patkányok vizsgálatában azt találták, hogy az urolithin B enyhíti a vesekárosodást. Javította a vesefunkciót, a vese morfológiáját, és csökkentette a vesekárosodási markereket. Ez azt jelzi, hogy az UB képes volt enyhíteni a vesegyulladást.

(6) Az urolitin A és B szinergetikus előnyei
Szinergetikus hatásokról számoltak be az urolitin A és B kognitív funkciói és kapacitása tekintetében is. A tanulmány kimondta, hogy ez a kombináció alkalmazható a demenciával kapcsolatos rendellenességek, például szorongás vagy Alzheimer-kór kezelésében vagy megelőzésében.

Az urolitinekkel kapcsolatos egyéb előnyök;

  • neuroprotekcióban
  • Javítja a metabolikus szindrómát

 

Urolithin A és B táplálékforrások

Az urolitinek természetesen nem találhatók táplálékforrásokban. Ezek az ellagitanninokból származó ellagsavak átalakításának termékei. Az ellagitannineket a bél mikrobiota átalakítja elláginsavakká, és az vastagbélben az ellagicsav tovább metabolitjaikké (urolitinek) alakul át.

Az elagitanninok természetesen előfordulnak olyan élelmiszer-forrásokban, mint a gránátalma, a bogyós gyümölcsök, beleértve az epret, a málnát, az áfonyát és a szedret, a muszkadinos szőlő, a mandula, a guava, a tea és a diófélék, például a dió és a gesztenye, valamint a tölgyben érlelt italok, például a vörösbor és a whisky. tölgyfahordók.

Ezért arra következtethetünk, hogy az urolitin A-ételek és az urolitin B-ételek ellagitanninban gazdag ételek. Érdemes megjegyezni, hogy az ellagitinin biohasznosulása nagyon korlátozott, míg másodlagos metabolitjai (urolitin) biológiailag könnyen elérhetőek.

Az urolitinek kiválasztása és termelése nagymértékben változik az egyének között, mivel az ellagitanninokból történő átalakulás a bél mikrobiotájára támaszkodik. Specifikus baktériumok vesznek részt ezekben a konverziókban, és azok az egyének között eltérőek, ahol némelyiknek magas, alacsony vagy egyáltalán nincs megfelelő mikrobiota. Az élelmiszerforrások ellagitanninszintjükben is eltérnek. Ezért az ellagitanninok potenciális előnyei egyénenként változnak.

 

Urolithin A és B kiegészítők

Az Urolithin A-kiegészítők, valamint az Urolithin B-kiegészítők könnyen megtalálhatók a piacon, mint ellagitanninban gazdag étrend-kiegészítők. Az urolithin A-kiegészítők szintén könnyen elérhetők. Főleg a gránátalma-kiegészítőket széles körben értékesítették és sikeresen használták. Ezeket a kiegészítőket szintetizálják a gyümölcsökből vagy diófélékből, és folyékony vagy por formában formálják.

A különböző élelmiszerek ellagitannin-koncentrációjának változása miatt az urolitin vásárlói figyelembe veszik az élelmiszer-forrást. Ugyanez vonatkozik az urolitin B por vagy folyékony kiegészítők beszerzésére is.

Az urolithin A porral vagy B-vel végzett néhány humán klinikai vizsgálat nem számolt be ezeknek a kiegészítőknek az alkalmazásából származó súlyos mellékhatásokról.

Referencia

  1. Garcia-Muñoz, Cristina; Vaillant, Fabrice (2014-12-02). „Az ellagitanninek metabolikus sorsa: következmények az egészségre és az innovatív funkcionális élelmiszerek kutatási perspektívái”. Kritikus vélemények az élelmiszer -tudományban és a táplálkozásban.
  2. Bialonska D, Kasimsetty SG, Khan SI, Ferreira D (11. november 2009.). „Az urolitinek, a gránátalma-ellagitanninok bél mikrobiális metabolitjai, erős antioxidáns aktivitást mutatnak egy sejt alapú vizsgálatban”. J Agric Food Chem.
  3. Bodwell, Graham; Pottie, Ian; Nandaluru, Penchal (2011). „Inverz elektron-kereslet Diels-éger alapú teljes Urolithin M7 szintézis”.