Urolitin B por

November 9, 2020

Urolithin BSECHNIKAI

Név: Urolitin B
Kémiai név: 3-Hidroxi-6H-dibenzo [b, d] pirán-6-on
CAS: 1139-83-9
Kémiai formula: C13H8O3
Molekuláris tömeg: X
Szín:  Fehér por
InChi kulcs: WXUQMTRHPNOXBV-UHFFFAOYSA-N
SMILES kód: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
Funkció: Az urolithin B javíthatja a mitokondriális és izomműködést.

Az Urolithin B javítja az izomerőt és az állóképességet az öregedés során.

Alkalmazás: Az urolithin B az ellagitannis bélben található mikrobiális metabolitja, és erős antioxidáns és prooxidáns aktivitást mutat, a vizsgálati rendszertől és a körülményektől függően. Az Urolithin B ösztrogén és / vagy antiösztrogén aktivitást is mutathat.
Oldékonyság: Könnyen oldódik N, N-dimetil-formamidban és dimetil-metilénben. Szulfon, metanolban, etanolban és etil-acetátban kissé oldódik
Tárolási hőmérséklet: Higroszkópos, -20 ° C Fagyasztó, Inert atmoszférában
Szállítási állapot: A környezeti hőmérsékleten nem veszélyes vegyi anyagként szállítják. Ez a termék elég stabil ahhoz, hogy néhány hét alatt a szokásos szállítás és a vám alatt töltött idő.

 

Urolitin B NMR-spektrum

Urolitin B (1139-83-9) - NMR-spektrum

 

Ha minden egyes termékhez COA-ra, MSDS-re és HNMR-re és egyéb információkra van szüksége, kérjük, lépjen kapcsolatba velünk marketing menedzser.